C16H25ClFIN2O3SSi — CID 155656191
N-(2-chloro-4-fluoro-3-iodophenyl)-N-(2-trimethylsilylethoxymethyl)pyrrolidine-1-sulfonamide (PubChem CID 155656191) has the molecular formula C16H25ClFIN2O3SSi and a molecular weight of 534.90 g/mol. Its IUPAC name is N-(2-chloro-4-fluoro-3-iodophenyl)-N-(2-trimethylsilylethoxymethyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(2-chloro-4-fluoro-3-iodophenyl)-N-(2-trimethylsilylethoxymethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 155656191 |
| Molecular Formula | C16H25ClFIN2O3SSi |
| Molecular Weight | 534.90 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | N-(2-chloro-4-fluoro-3-iodophenyl)-N-(2-trimethylsilylethoxymethyl)pyrrolidine-1-sulfonamide |
| SMILES | C[Si](C)(C)CCOCN(c1ccc(F)c(I)c1Cl)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C16H25ClFIN2O3SSi/c1-26(2,3)11-10-24-12-21(25(22,23)20-8-4-5-9-20)14-7-6-13(18)16(19)15(14)17/h6-7H,4-5,8-12H2,1-3H3 |
| InChIKey | ZULTXPJXEZOLHM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|