C23H32ClN3O4SSi — CID 123926785
N-[1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide (PubChem CID 123926785) has the molecular formula C23H32ClN3O4SSi and a molecular weight of 510.13 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
|---|---|
| PubChem CID | 123926785 |
| Molecular Formula | C23H32ClN3O4SSi |
| Molecular Weight | 510.13 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
| SMILES | CC(CO)(c1ccc(Cl)cc1)n1ncc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C23H32ClN3O4SSi/c1-23(16-28,18-9-11-19(24)12-10-18)27-22-8-6-7-21(20(22)15-25-27)26(32(2,29)30)17-31-13-14-33(3,4)5/h6-12,15,28H,13-14,16-17H2,1-5H3 |
| InChIKey | VZVSGFJRXGVLDH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.13 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|