C27H33ClN2O5SSi — CID 86705051
4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoic acid (PubChem CID 86705051) has the molecular formula C27H33ClN2O5SSi and a molecular weight of 561.18 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoic acid.
| Compound Name | 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoic acid |
|---|---|
| PubChem CID | 86705051 |
| Molecular Formula | C27H33ClN2O5SSi |
| Molecular Weight | 561.18 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoic acid |
| SMILES | CCC(C#CC(=O)O)(c1ccc(Cl)cc1)n1ccc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C27H33ClN2O5SSi/c1-6-27(16-14-26(31)32,21-10-12-22(28)13-11-21)29-17-15-23-24(29)8-7-9-25(23)30(36(2,33)34)20-35-18-19-37(3,4)5/h7-13,15,17H,6,18-20H2,1-5H3,(H,31,32) |
| InChIKey | BIIQNVGTJNOPOM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.18 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|