C21H22ClN4O5S- — CID 174803670
[[1-[2-(4-chlorophenyl)-1-[(N-hydroxy-C-methylcarbonimidoyl)amino]-1-oxobutan-2-yl]indol-4-yl]-methylamino] sulfite (PubChem CID 174803670) has the molecular formula C21H22ClN4O5S- and a molecular weight of 477.95 g/mol. Its IUPAC name is [[1-[2-(4-chlorophenyl)-1-[(N-hydroxy-C-methylcarbonimidoyl)amino]-1-oxobutan-2-yl]indol-4-yl]-methylamino] sulfite.
| Compound Name | [[1-[2-(4-chlorophenyl)-1-[(N-hydroxy-C-methylcarbonimidoyl)amino]-1-oxobutan-2-yl]indol-4-yl]-methylamino] sulfite |
|---|---|
| PubChem CID | 174803670 |
| Molecular Formula | C21H22ClN4O5S- |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [[1-[2-(4-chlorophenyl)-1-[(N-hydroxy-C-methylcarbonimidoyl)amino]-1-oxobutan-2-yl]indol-4-yl]-methylamino] sulfite |
| SMILES | CCC(C(=O)NC(C)=NO)(c1ccc(Cl)cc1)n1ccc2c(N(C)OS(=O)[O-])cccc21 |
| InChI | InChI=1S/C21H23ClN4O5S/c1-4-21(20(27)23-14(2)24-28,15-8-10-16(22)11-9-15)26-13-12-17-18(6-5-7-19(17)26)25(3)31-32(29)30/h5-13,28H,4H2,1-3H3,(H,29,30)(H,23,24,27)/p-1 |
| InChIKey | HDZUHWRQTWWQAM-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|