C19H21ClN3O5S- — CID 174706707
[[1-(1-carboxybutyl)-2-(4-chlorophenyl)-3H-indazol-4-yl]-methylamino] sulfite (PubChem CID 174706707) has the molecular formula C19H21ClN3O5S- and a molecular weight of 438.91 g/mol. Its IUPAC name is [[1-(1-carboxybutyl)-2-(4-chlorophenyl)-3H-indazol-4-yl]-methylamino] sulfite.
| Compound Name | [[1-(1-carboxybutyl)-2-(4-chlorophenyl)-3H-indazol-4-yl]-methylamino] sulfite |
|---|---|
| PubChem CID | 174706707 |
| Molecular Formula | C19H21ClN3O5S- |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [[1-(1-carboxybutyl)-2-(4-chlorophenyl)-3H-indazol-4-yl]-methylamino] sulfite |
| SMILES | CCCC(C(=O)O)N1c2cccc(N(C)OS(=O)[O-])c2CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O5S/c1-3-5-18(19(24)25)23-17-7-4-6-16(21(2)28-29(26)27)15(17)12-22(23)14-10-8-13(20)9-11-14/h4,6-11,18H,3,5,12H2,1-2H3,(H,24,25)(H,26,27)/p-1 |
| InChIKey | QJRFQBVHKRBQFV-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|