C20H20ClN2O5S- — CID 174693985
[[1-[1-carboxy-3-(4-chlorophenyl)butyl]indol-4-yl]amino]methyl sulfite (PubChem CID 174693985) has the molecular formula C20H20ClN2O5S- and a molecular weight of 435.91 g/mol. Its IUPAC name is [[1-[1-carboxy-3-(4-chlorophenyl)butyl]indol-4-yl]amino]methyl sulfite.
| Compound Name | [[1-[1-carboxy-3-(4-chlorophenyl)butyl]indol-4-yl]amino]methyl sulfite |
|---|---|
| PubChem CID | 174693985 |
| Molecular Formula | C20H20ClN2O5S- |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [[1-[1-carboxy-3-(4-chlorophenyl)butyl]indol-4-yl]amino]methyl sulfite |
| SMILES | CC(CC(C(=O)O)n1ccc2c(NCOS(=O)[O-])cccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O5S/c1-13(14-5-7-15(21)8-6-14)11-19(20(24)25)23-10-9-16-17(3-2-4-18(16)23)22-12-28-29(26)27/h2-10,13,19,22H,11-12H2,1H3,(H,24,25)(H,26,27)/p-1 |
| InChIKey | NXQJVTACNXPCAZ-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|