C23H20Cl2O3 — CID 151214725
5-[1,3-bis(4-chlorophenyl)butyl]-2-hydroxybenzoic acid (PubChem CID 151214725) has the molecular formula C23H20Cl2O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is 5-[1,3-bis(4-chlorophenyl)butyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[1,3-bis(4-chlorophenyl)butyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 151214725 |
| Molecular Formula | C23H20Cl2O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-[1,3-bis(4-chlorophenyl)butyl]-2-hydroxybenzoic acid |
| SMILES | CC(CC(c1ccc(Cl)cc1)c1ccc(O)c(C(=O)O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2O3/c1-14(15-2-7-18(24)8-3-15)12-20(16-4-9-19(25)10-5-16)17-6-11-22(26)21(13-17)23(27)28/h2-11,13-14,20,26H,12H2,1H3,(H,27,28) |
| InChIKey | NKZXRSRTPDNPIC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |