C29H28Cl2NO6S- — CID 137355606
[3-[[(2S,5R,6S)-4-[(1R)-1-carboxybutyl]-5,6-bis(4-chlorophenyl)-3-oxomorpholin-2-yl]methyl]phenyl]methanesulfinate (PubChem CID 137355606) has the molecular formula C29H28Cl2NO6S- and a molecular weight of 589.52 g/mol. Its IUPAC name is [3-[[(2S,5R,6S)-4-[(1R)-1-carboxybutyl]-5,6-bis(4-chlorophenyl)-3-oxomorpholin-2-yl]methyl]phenyl]methanesulfinate.
| Compound Name | [3-[[(2S,5R,6S)-4-[(1R)-1-carboxybutyl]-5,6-bis(4-chlorophenyl)-3-oxomorpholin-2-yl]methyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 137355606 |
| Molecular Formula | C29H28Cl2NO6S- |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | [3-[[(2S,5R,6S)-4-[(1R)-1-carboxybutyl]-5,6-bis(4-chlorophenyl)-3-oxomorpholin-2-yl]methyl]phenyl]methanesulfinate |
| SMILES | CCCC(C(=O)O)N1C(=O)[C@H](Cc2cccc(CS(=O)[O-])c2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H29Cl2NO6S/c1-2-4-24(29(34)35)32-26(20-7-11-22(30)12-8-20)27(21-9-13-23(31)14-10-21)38-25(28(32)33)16-18-5-3-6-19(15-18)17-39(36)37/h3,5-15,24-27H,2,4,16-17H2,1H3,(H,34,35)(H,36,37)/p-1/t24?,25-,26+,27-/m0/s1 |
| InChIKey | HEVMEWUUGWEOIO-ZAEYVGPMSA-M |
| XLogP | 5.88 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|