C28H26Cl2FIN2O3 — CID 90372044
(2R)-2-[(2S,3R,6S)-2,3-bis(4-chlorophenyl)-6-[(3-fluoro-4-iodophenyl)methyl]-5-oxomorpholin-4-yl]pentanamide (PubChem CID 90372044) has the molecular formula C28H26Cl2FIN2O3 and a molecular weight of 655.34 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,6S)-2,3-bis(4-chlorophenyl)-6-[(3-fluoro-4-iodophenyl)methyl]-5-oxomorpholin-4-yl]pentanamide.
| Compound Name | (2R)-2-[(2S,3R,6S)-2,3-bis(4-chlorophenyl)-6-[(3-fluoro-4-iodophenyl)methyl]-5-oxomorpholin-4-yl]pentanamide |
|---|---|
| PubChem CID | 90372044 |
| Molecular Formula | C28H26Cl2FIN2O3 |
| Molecular Weight | 655.34 g/mol |
| Exact Mass | 654.03 |
| IUPAC Name | (2R)-2-[(2S,3R,6S)-2,3-bis(4-chlorophenyl)-6-[(3-fluoro-4-iodophenyl)methyl]-5-oxomorpholin-4-yl]pentanamide |
| SMILES | CCCC(C(N)=O)N1C(=O)[C@H](Cc2ccc(I)c(F)c2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2FIN2O3/c1-2-3-23(27(33)35)34-25(17-5-9-19(29)10-6-17)26(18-7-11-20(30)12-8-18)37-24(28(34)36)15-16-4-13-22(32)21(31)14-16/h4-14,23-26H,2-3,15H2,1H3,(H2,33,35)/t23?,24-,25+,26-/m0/s1 |
| InChIKey | MBKHHHGZBJXXMC-VGPBXHGJSA-N |
| XLogP | 6.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.34 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|