C28H24Cl2FIN2O2 — CID 161226594
(2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(3-fluoro-4-iodophenyl)methyl]-4-[(1S)-1-isocyanobutyl]morpholin-3-one (PubChem CID 161226594) has the molecular formula C28H24Cl2FIN2O2 and a molecular weight of 637.32 g/mol. Its IUPAC name is (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(3-fluoro-4-iodophenyl)methyl]-4-[(1S)-1-isocyanobutyl]morpholin-3-one.
| Compound Name | (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(3-fluoro-4-iodophenyl)methyl]-4-[(1S)-1-isocyanobutyl]morpholin-3-one |
|---|---|
| PubChem CID | 161226594 |
| Molecular Formula | C28H24Cl2FIN2O2 |
| Molecular Weight | 637.32 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | (2S,5R,6S)-5,6-bis(4-chlorophenyl)-2-[(3-fluoro-4-iodophenyl)methyl]-4-[(1S)-1-isocyanobutyl]morpholin-3-one |
| SMILES | [C-]#[N+][C@@H](CCC)N1C(=O)[C@H](Cc2ccc(I)c(F)c2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24Cl2FIN2O2/c1-3-4-25(33-2)34-26(18-6-10-20(29)11-7-18)27(19-8-12-21(30)13-9-19)36-24(28(34)35)16-17-5-14-23(32)22(31)15-17/h5-15,24-27H,3-4,16H2,1H3/t24-,25+,26+,27-/m0/s1 |
| InChIKey | UYFASXNRLNSYRP-YAOOYPAMSA-N |
| XLogP | 8.04 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.32 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|