C27H26Cl2INO2 — CID 118631961
(2S,5R,6S)-4-butyl-5,6-bis(4-chlorophenyl)-2-[(4-iodophenyl)methyl]morpholin-3-one (PubChem CID 118631961) has the molecular formula C27H26Cl2INO2 and a molecular weight of 594.32 g/mol. Its IUPAC name is (2S,5R,6S)-4-butyl-5,6-bis(4-chlorophenyl)-2-[(4-iodophenyl)methyl]morpholin-3-one.
| Compound Name | (2S,5R,6S)-4-butyl-5,6-bis(4-chlorophenyl)-2-[(4-iodophenyl)methyl]morpholin-3-one |
|---|---|
| PubChem CID | 118631961 |
| Molecular Formula | C27H26Cl2INO2 |
| Molecular Weight | 594.32 g/mol |
| Exact Mass | 593.04 |
| IUPAC Name | (2S,5R,6S)-4-butyl-5,6-bis(4-chlorophenyl)-2-[(4-iodophenyl)methyl]morpholin-3-one |
| SMILES | CCCCN1C(=O)[C@H](Cc2ccc(I)cc2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26Cl2INO2/c1-2-3-16-31-25(19-6-10-21(28)11-7-19)26(20-8-12-22(29)13-9-20)33-24(27(31)32)17-18-4-14-23(30)15-5-18/h4-15,24-26H,2-3,16-17H2,1H3/t24-,25+,26-/m0/s1 |
| InChIKey | MKCMIUHLPLTDCN-NXCFDTQHSA-N |
| XLogP | 7.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.32 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|