C28H26Cl2FNO3 — CID 123473411
2-[2,3-bis(4-chlorophenyl)-6-[(4-fluorophenyl)methyl]-5-oxomorpholin-4-yl]pentanal (PubChem CID 123473411) has the molecular formula C28H26Cl2FNO3 and a molecular weight of 514.42 g/mol. Its IUPAC name is 2-[2,3-bis(4-chlorophenyl)-6-[(4-fluorophenyl)methyl]-5-oxomorpholin-4-yl]pentanal.
| Compound Name | 2-[2,3-bis(4-chlorophenyl)-6-[(4-fluorophenyl)methyl]-5-oxomorpholin-4-yl]pentanal |
|---|---|
| PubChem CID | 123473411 |
| Molecular Formula | C28H26Cl2FNO3 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[2,3-bis(4-chlorophenyl)-6-[(4-fluorophenyl)methyl]-5-oxomorpholin-4-yl]pentanal |
| SMILES | CCCC(C=O)N1C(=O)C(Cc2ccc(F)cc2)OC(c2ccc(Cl)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26Cl2FNO3/c1-2-3-24(17-33)32-26(19-6-10-21(29)11-7-19)27(20-8-12-22(30)13-9-20)35-25(28(32)34)16-18-4-14-23(31)15-5-18/h4-15,17,24-27H,2-3,16H2,1H3 |
| InChIKey | FPRXOSZCVBMVBV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|