C33H39FN2O4 — CID 123301625
4-[2-(4-aminophenyl)-6-[(4-fluorophenyl)methyl]-5-oxo-3-(4-propylphenyl)morpholin-4-yl]heptanoic acid (PubChem CID 123301625) has the molecular formula C33H39FN2O4 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)-6-[(4-fluorophenyl)methyl]-5-oxo-3-(4-propylphenyl)morpholin-4-yl]heptanoic acid.
| Compound Name | 4-[2-(4-aminophenyl)-6-[(4-fluorophenyl)methyl]-5-oxo-3-(4-propylphenyl)morpholin-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 123301625 |
| Molecular Formula | C33H39FN2O4 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 4-[2-(4-aminophenyl)-6-[(4-fluorophenyl)methyl]-5-oxo-3-(4-propylphenyl)morpholin-4-yl]heptanoic acid |
| SMILES | CCCc1ccc(C2C(c3ccc(N)cc3)OC(Cc3ccc(F)cc3)C(=O)N2C(CCC)CCC(=O)O)cc1 |
| InChI | InChI=1S/C33H39FN2O4/c1-3-5-22-7-11-24(12-8-22)31-32(25-13-17-27(35)18-14-25)40-29(21-23-9-15-26(34)16-10-23)33(39)36(31)28(6-4-2)19-20-30(37)38/h7-18,28-29,31-32H,3-6,19-21,35H2,1-2H3,(H,37,38) |
| InChIKey | WKGWCXWWPWKLSQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|