About 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid
2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid (PubChem CID 163942971) has the molecular formula C29H32N2O4
and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid.
Molecular Properties
| Compound Name | 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid |
| PubChem CID | 163942971 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1C(=O)[C@@H](Cc2ccncc2)OC(c2ccc(C)cc2)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C29H32N2O4/c1-4-5-24(29(33)34)31-26(22-10-6-19(2)7-11-22)27(23-12-8-20(3)9-13-23)35-25(28(31)32)18-21-14-16-30-17-15-21/h6-17,24-27H,4-5,18H2,1-3H3,(H,33,34)/t24?,25-,26?,27?/m1/s1 |
| InChIKey | RSQCXOKMNYANMH-HCGFHUCKSA-N |
| XLogP | 5.20 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid?
The IUPAC name of 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid (CID 163942971) is 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid.
What is the SMILES notation for 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid?
The canonical SMILES for 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid is CCCC(C(=O)O)N1C(=O)[C@@H](Cc2ccncc2)OC(c2ccc(C)cc2)C1c1ccc(C)cc1.
What is the InChIKey of 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid?
The InChIKey is RSQCXOKMNYANMH-HCGFHUCKSA-N. The full InChI is InChI=1S/C29H32N2O4/c1-4-5-24(29(33)34)31-26(22-10-6-19(2)7-11-22)27(23-12-8-20(3)9-13-23)35-25(28(31)32)18-21-14-16-30-17-15-21/h6-17,24-27H,4-5,18H2,1-3H3,(H,33,34)/t24?,25-,26?,27?/m1/s1.
What are the key properties of 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid?
2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid has a molecular weight of 472.59 g/mol, XLogP of 5.20, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6R)-2,3-bis(4-methylphenyl)-5-oxo-6-(pyridin-4-ylmethyl)morpholin-4-yl]pentanoic acid is sourced from PubChem (CID 163942971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).