C19H18F3N3O4S — CID 90031080
2-[4-(methanesulfonamido)indazol-1-yl]-2-[4-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 90031080) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is 2-[4-(methanesulfonamido)indazol-1-yl]-2-[4-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 2-[4-(methanesulfonamido)indazol-1-yl]-2-[4-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 90031080 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[4-(methanesulfonamido)indazol-1-yl]-2-[4-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)(c1ccc(C(F)(F)F)cc1)n1ncc2c(NS(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-3-18(17(26)27,12-7-9-13(10-8-12)19(20,21)22)25-16-6-4-5-15(14(16)11-23-25)24-30(2,28)29/h4-11,24H,3H2,1-2H3,(H,26,27) |
| InChIKey | LJELQMQRTXYOIU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |