C25H27ClN4O2 — CID 142767719
tert-butyl N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]methyl]carbamate (PubChem CID 142767719) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is tert-butyl N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 142767719 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | tert-butyl N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]methyl]carbamate |
| SMILES | CCC(/C=C/C#N)(c1ccc(Cl)cc1)n1ncc2c(CNC(=O)OC(C)(C)C)cccc21 |
| InChI | InChI=1S/C25H27ClN4O2/c1-5-25(14-7-15-27,19-10-12-20(26)13-11-19)30-22-9-6-8-18(21(22)17-29-30)16-28-23(31)32-24(2,3)4/h6-14,17H,5,16H2,1-4H3,(H,28,31)/b14-7+ |
| InChIKey | MEYCHQZMNIWBSH-VGOFMYFVSA-N |
| XLogP | 5.95 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|