C13H16FNO3S — CID 123878076
1-[1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidin-2-yl]ethanone (PubChem CID 123878076) has the molecular formula C13H16FNO3S and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 123878076 |
| Molecular Formula | C13H16FNO3S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-[1-(4-fluorophenyl)sulfonyl-5-methylpyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)C1CCC(C)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO3S/c1-9-3-8-13(10(2)16)15(9)19(17,18)12-6-4-11(14)5-7-12/h4-7,9,13H,3,8H2,1-2H3 |
| InChIKey | GIIZOFCCAAAUPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |