C7H10FN — CID 123879479
2-fluoro-5-methylhexa-1,4-dien-3-imine (PubChem CID 123879479) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 2-fluoro-5-methylhexa-1,4-dien-3-imine.
| Compound Name | 2-fluoro-5-methylhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123879479 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 2-fluoro-5-methylhexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(\C=C(C)C)C(=C)F |
| InChI | InChI=1S/C7H10FN/c1-5(2)4-7(9)6(3)8/h4,9H,3H2,1-2H3/b9-7+ |
| InChIKey | FBFHDGLWUYZOFH-VQHVLOKHSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|