C21H23F3N2O4 — CID 123880253
[2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-[3-hydroxy-3-(2-hydroxyethoxymethyl)azetidin-1-yl]methanone (PubChem CID 123880253) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is [2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-[3-hydroxy-3-(2-hydroxyethoxymethyl)azetidin-1-yl]methanone.
| Compound Name | [2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-[3-hydroxy-3-(2-hydroxyethoxymethyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 123880253 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-[3-hydroxy-3-(2-hydroxyethoxymethyl)azetidin-1-yl]methanone |
| SMILES | CCc1ccc(Nc2c(C(=O)N3CC(O)(COCCO)C3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-2-13-3-6-17(16(23)9-13)25-19-14(4-5-15(22)18(19)24)20(28)26-10-21(29,11-26)12-30-8-7-27/h3-6,9,25,27,29H,2,7-8,10-12H2,1H3 |
| InChIKey | OHSRIVFPROHCBO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|