C24H34O4 — CID 123880459
10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-2-ene-15,5'-oxolane]-2',5,7-triol (PubChem CID 123880459) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-2-ene-15,5'-oxolane]-2',5,7-triol.
| Compound Name | 10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-2-ene-15,5'-oxolane]-2',5,7-triol |
|---|---|
| PubChem CID | 123880459 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-2-ene-15,5'-oxolane]-2',5,7-triol |
| SMILES | CC12CCC(O)CC1(O)C1C=C1C1C2CCC2(C)C1C1CC1C21CCC(O)O1 |
| InChI | InChI=1S/C24H34O4/c1-21-6-3-12(25)11-23(21,27)16-9-13(16)19-15(21)4-7-22(2)20(19)14-10-17(14)24(22)8-5-18(26)28-24/h9,12,14-20,25-27H,3-8,10-11H2,1-2H3 |
| InChIKey | FUTOQDYESQBWLJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|