C22H32O3 — CID 89023592
(5R,7S,10R,14S,15S)-10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-15,2'-oxirane]-5,7-diol (PubChem CID 89023592) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5R,7S,10R,14S,15S)-10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-15,2'-oxirane]-5,7-diol.
| Compound Name | (5R,7S,10R,14S,15S)-10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-15,2'-oxirane]-5,7-diol |
|---|---|
| PubChem CID | 89023592 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5R,7S,10R,14S,15S)-10,14-dimethylspiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-15,2'-oxirane]-5,7-diol |
| SMILES | C[C@]12CCC3C(C4CC4[C@]4(O)C[C@@H](O)CC[C@]34C)C1C1CC1[C@@]21CO1 |
| InChI | InChI=1S/C22H32O3/c1-19-5-3-11(23)9-21(19,24)15-7-12(15)17-14(19)4-6-20(2)18(17)13-8-16(13)22(20)10-25-22/h11-18,23-24H,3-10H2,1-2H3/t11-,12?,13?,14?,15?,16?,17?,18?,19+,20-,21+,22-/m0/s1 |
| InChIKey | PHQPTHGZYLVJCL-QKMAPNNZSA-N |
| XLogP | 2.99 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|