C27H46O4Si — CID 59475670
(2R,4R,5R,7S,10R,14S,15S,16S,18S)-10,14-dimethyl-15-(3-trimethylsilyloxypropyl)hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-5,7,15-triol (PubChem CID 59475670) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (2R,4R,5R,7S,10R,14S,15S,16S,18S)-10,14-dimethyl-15-(3-trimethylsilyloxypropyl)hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-5,7,15-triol.
| Compound Name | (2R,4R,5R,7S,10R,14S,15S,16S,18S)-10,14-dimethyl-15-(3-trimethylsilyloxypropyl)hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-5,7,15-triol |
|---|---|
| PubChem CID | 59475670 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (2R,4R,5R,7S,10R,14S,15S,16S,18S)-10,14-dimethyl-15-(3-trimethylsilyloxypropyl)hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecane-5,7,15-triol |
| SMILES | C[C@]12CCC3C(C1C1C[C@@H]1[C@@]2(O)CCCO[Si](C)(C)C)[C@H]1C[C@H]1[C@]1(O)C[C@@H](O)CC[C@]31C |
| InChI | InChI=1S/C27H46O4Si/c1-24-10-7-16(28)15-27(24,30)20-13-17(20)22-19(24)8-11-25(2)23(22)18-14-21(18)26(25,29)9-6-12-31-32(3,4)5/h16-23,28-30H,6-15H2,1-5H3/t16-,17-,18?,19?,20+,21-,22?,23?,24+,25-,26-,27+/m0/s1 |
| InChIKey | JNACXXBHHQTMSR-IKONZKMUSA-N |
| XLogP | 4.58 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|