C26H36O5 — CID 75303625
ethyl 3-(5,7,15-trihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl)prop-2-ynoate (PubChem CID 75303625) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is ethyl 3-(5,7,15-trihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl)prop-2-ynoate.
| Compound Name | ethyl 3-(5,7,15-trihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl)prop-2-ynoate |
|---|---|
| PubChem CID | 75303625 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | ethyl 3-(5,7,15-trihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl)prop-2-ynoate |
| SMILES | CCOC(=O)C#CC1(O)C2CC2C2C3C4CC4C4(O)CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H36O5/c1-4-31-20(28)7-10-25(29)19-12-16(19)22-21-15-11-18(15)26(30)13-14(27)5-8-23(26,2)17(21)6-9-24(22,25)3/h14-19,21-22,27,29-30H,4-6,8-9,11-13H2,1-3H3 |
| InChIKey | NHJIUAKWEWFIRB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|