C16H21N6O+ — CID 123882266
(2-deuterio-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-ylidene)-[(3S,4R)-2,2,3,5,5,6,6-heptadeuterio-1-(2,2-dideuterio-2-isocyanoacetyl)-4-methylpiperidin-3-yl]-methylazanium (PubChem CID 123882266) has the molecular formula C16H21N6O+ and a molecular weight of 323.45 g/mol. Its IUPAC name is (2-deuterio-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-ylidene)-[(3S,4R)-2,2,3,5,5,6,6-heptadeuterio-1-(2,2-dideuterio-2-isocyanoacetyl)-4-methylpiperidin-3-yl]-methylazanium.
| Compound Name | (2-deuterio-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-ylidene)-[(3S,4R)-2,2,3,5,5,6,6-heptadeuterio-1-(2,2-dideuterio-2-isocyanoacetyl)-4-methylpiperidin-3-yl]-methylazanium |
|---|---|
| PubChem CID | 123882266 |
| Molecular Formula | C16H21N6O+ |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | (2-deuterio-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-ylidene)-[(3S,4R)-2,2,3,5,5,6,6-heptadeuterio-1-(2,2-dideuterio-2-isocyanoacetyl)-4-methylpiperidin-3-yl]-methylazanium |
| SMILES | [2H]c1nc2[nH]ccc2/c(=[N+](/C)[C@@]2([2H])[C@H](C)C([2H])([2H])C([2H])([2H])N(C(=O)C([2H])([2H])[N+]#[C-])C2([2H])[2H])[nH]1 |
| InChI | InChI=1S/C16H20N6O/c1-11-5-7-22(14(23)8-17-2)9-13(11)21(3)16-12-4-6-18-15(12)19-10-20-16/h4,6,10-11,13H,5,7-9H2,1,3H3,(H,18,19,20)/p+1/t11-,13-/m1/s1/i5D2,7D2,8D2,9D2,10D,13D |
| InChIKey | YYMGYZDHOQYMFO-DRMZOVFMSA-O |
| XLogP | 0.45 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|