C16H20N6O — CID 89004127
1-[(4R,5R)-2,2,3,3,6,6-hexadeuterio-5-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-methylpiperidin-1-yl]-2-isocyanoethanone (PubChem CID 89004127) has the molecular formula C16H20N6O and a molecular weight of 319.42 g/mol. Its IUPAC name is 1-[(4R,5R)-2,2,3,3,6,6-hexadeuterio-5-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-methylpiperidin-1-yl]-2-isocyanoethanone.
| Compound Name | 1-[(4R,5R)-2,2,3,3,6,6-hexadeuterio-5-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-methylpiperidin-1-yl]-2-isocyanoethanone |
|---|---|
| PubChem CID | 89004127 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-[(4R,5R)-2,2,3,3,6,6-hexadeuterio-5-[(2-deuterio-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-methylpiperidin-1-yl]-2-isocyanoethanone |
| SMILES | [2H]c1nc(N(C)[C@@H]2[C@H](C)C([2H])([2H])C([2H])([2H])N(C(=O)C[N+]#[C-])C2([2H])[2H])c2cc[nH]c2n1 |
| InChI | InChI=1S/C16H20N6O/c1-11-5-7-22(14(23)8-17-2)9-13(11)21(3)16-12-4-6-18-15(12)19-10-20-16/h4,6,10-11,13H,5,7-9H2,1,3H3,(H,18,19,20)/t11-,13+/m1/s1/i5D2,7D2,9D2,10D |
| InChIKey | YYMGYZDHOQYMFO-PVPSGESFSA-N |
| XLogP | 1.55 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|