C29H54ClN9O — CID 123882371
N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-2-amino-4-(2-chloropentylamino)-6-ethyl-2,3,4,5-tetrahydropyridine-3-carboxamide (PubChem CID 123882371) has the molecular formula C29H54ClN9O and a molecular weight of 580.27 g/mol. Its IUPAC name is N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-2-amino-4-(2-chloropentylamino)-6-ethyl-2,3,4,5-tetrahydropyridine-3-carboxamide.
| Compound Name | N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-2-amino-4-(2-chloropentylamino)-6-ethyl-2,3,4,5-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 123882371 |
| Molecular Formula | C29H54ClN9O |
| Molecular Weight | 580.27 g/mol |
| Exact Mass | 579.41 |
| IUPAC Name | N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-2-amino-4-(2-chloropentylamino)-6-ethyl-2,3,4,5-tetrahydropyridine-3-carboxamide |
| SMILES | CCCC(Cl)CNC1CC(CC)=NC(N)C1C(=O)NC1CNCCC1N1CCC(N2CCN3CNCC3C2)CC1 |
| InChI | InChI=1S/C29H54ClN9O/c1-3-5-20(30)15-34-24-14-21(4-2)35-28(31)27(24)29(40)36-25-17-32-9-6-26(25)37-10-7-22(8-11-37)38-12-13-39-19-33-16-23(39)18-38/h20,22-28,32-34H,3-19,31H2,1-2H3,(H,36,40) |
| InChIKey | RXSMCDLQVHNROA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|