C19H21F3N6O3S2 — CID 123883037
5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-[3-(2,2,2-trifluoro-1-hydroxyethoxy)propyl]pyrimidin-2-yl]thiophene-2-sulfinamide (PubChem CID 123883037) has the molecular formula C19H21F3N6O3S2 and a molecular weight of 502.54 g/mol. Its IUPAC name is 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-[3-(2,2,2-trifluoro-1-hydroxyethoxy)propyl]pyrimidin-2-yl]thiophene-2-sulfinamide.
| Compound Name | 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-[3-(2,2,2-trifluoro-1-hydroxyethoxy)propyl]pyrimidin-2-yl]thiophene-2-sulfinamide |
|---|---|
| PubChem CID | 123883037 |
| Molecular Formula | C19H21F3N6O3S2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-[3-(2,2,2-trifluoro-1-hydroxyethoxy)propyl]pyrimidin-2-yl]thiophene-2-sulfinamide |
| SMILES | NS(=O)c1ccc(-c2ncc(CCCOC(O)C(F)(F)F)c(Nc3cc(C4CC4)[nH]n3)n2)s1 |
| InChI | InChI=1S/C19H21F3N6O3S2/c20-19(21,22)18(29)31-7-1-2-11-9-24-17(13-5-6-15(32-13)33(23)30)26-16(11)25-14-8-12(27-28-14)10-3-4-10/h5-6,8-10,18,29H,1-4,7,23H2,(H2,24,25,26,27,28) |
| InChIKey | JVQTXCQYYFAFJA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|