C12H23N3O6S — CID 123883821
methyl 2-[[2-amino-3-[2-[2-(methylamino)acetyl]oxyethylsulfanyl]propanoyl]amino]-3-hydroxypropanoate (PubChem CID 123883821) has the molecular formula C12H23N3O6S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 2-[[2-amino-3-[2-[2-(methylamino)acetyl]oxyethylsulfanyl]propanoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-amino-3-[2-[2-(methylamino)acetyl]oxyethylsulfanyl]propanoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 123883821 |
| Molecular Formula | C12H23N3O6S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 2-[[2-amino-3-[2-[2-(methylamino)acetyl]oxyethylsulfanyl]propanoyl]amino]-3-hydroxypropanoate |
| SMILES | CNCC(=O)OCCSCC(N)C(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C12H23N3O6S/c1-14-5-10(17)21-3-4-22-7-8(13)11(18)15-9(6-16)12(19)20-2/h8-9,14,16H,3-7,13H2,1-2H3,(H,15,18) |
| InChIKey | JKFXCGLDWFCDEW-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|