C13H15F3N2 — CID 123884907
4-ethyl-1-hepta-1,3,5-trien-2-yl-5-(trifluoromethyl)pyrazole (PubChem CID 123884907) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 4-ethyl-1-hepta-1,3,5-trien-2-yl-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-ethyl-1-hepta-1,3,5-trien-2-yl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 123884907 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-ethyl-1-hepta-1,3,5-trien-2-yl-5-(trifluoromethyl)pyrazole |
| SMILES | C=C(C=CC=CC)n1ncc(CC)c1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2/c1-4-6-7-8-10(3)18-12(13(14,15)16)11(5-2)9-17-18/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | ROLLLSRSNOPFFV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|