C14H8F9IrN2- — CID 58621571
1-[3-ethyl-5-(trifluoromethyl)benzene-2-id-1-yl]-4,5-bis(trifluoromethyl)pyrazole;iridium (PubChem CID 58621571) has the molecular formula C14H8F9IrN2- and a molecular weight of 567.43 g/mol. Its IUPAC name is 1-[3-ethyl-5-(trifluoromethyl)benzene-2-id-1-yl]-4,5-bis(trifluoromethyl)pyrazole;iridium.
| Compound Name | 1-[3-ethyl-5-(trifluoromethyl)benzene-2-id-1-yl]-4,5-bis(trifluoromethyl)pyrazole;iridium |
|---|---|
| PubChem CID | 58621571 |
| Molecular Formula | C14H8F9IrN2- |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | 1-[3-ethyl-5-(trifluoromethyl)benzene-2-id-1-yl]-4,5-bis(trifluoromethyl)pyrazole;iridium |
| SMILES | CCc1[c-]c(-n2ncc(C(F)(F)F)c2C(F)(F)F)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C14H8F9N2.Ir/c1-2-7-3-8(12(15,16)17)5-9(4-7)25-11(14(21,22)23)10(6-24-25)13(18,19)20;/h3,5-6H,2H2,1H3;/q-1; |
| InChIKey | HYJLPRJEHSNWKB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|