C14H19F3N2 — CID 143930378
ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 143930378) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 143930378 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | C=C/C=C(\C=C/C)n1ncc(C)c1C(F)(F)F.CC |
| InChI | InChI=1S/C12H13F3N2.C2H6/c1-4-6-10(7-5-2)17-11(12(13,14)15)9(3)8-16-17;1-2/h4-8H,1H2,2-3H3;1-2H3/b7-5-,10-6+; |
| InChIKey | NNJUMEOPBRKXLN-RQLYHSFASA-N |
| XLogP | 4.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|