C11H15FN2 — CID 123885013
(1E,5Z)-N-(2-fluoroethyl)-4-imino-N-methylcycloocta-1,5,7-trien-1-amine (PubChem CID 123885013) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is (1E,5Z)-N-(2-fluoroethyl)-4-imino-N-methylcycloocta-1,5,7-trien-1-amine.
| Compound Name | (1E,5Z)-N-(2-fluoroethyl)-4-imino-N-methylcycloocta-1,5,7-trien-1-amine |
|---|---|
| PubChem CID | 123885013 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (1E,5Z)-N-(2-fluoroethyl)-4-imino-N-methylcycloocta-1,5,7-trien-1-amine |
| SMILES | [H]/N=C1/C=C\C=C/C(N(C)CCF)=C\C1 |
| InChI | InChI=1S/C11H15FN2/c1-14(9-8-12)11-5-3-2-4-10(13)6-7-11/h2-5,7,13H,6,8-9H2,1H3/b4-2-,5-3?,11-7+,13-10- |
| InChIKey | PAPWFRWHQHLXAG-NNIZZVAGSA-N |
| XLogP | 2.31 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|