C8H5N3 — CID 123885255
penta-1,4-diene-1,1,5-tricarbonitrile (PubChem CID 123885255) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is penta-1,4-diene-1,1,5-tricarbonitrile.
| Compound Name | penta-1,4-diene-1,1,5-tricarbonitrile |
|---|---|
| PubChem CID | 123885255 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | penta-1,4-diene-1,1,5-tricarbonitrile |
| SMILES | N#CC=CCC=C(C#N)C#N |
| InChI | InChI=1S/C8H5N3/c9-5-3-1-2-4-8(6-10)7-11/h1,3-4H,2H2 |
| InChIKey | SDYUARPGRAIGFB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|