C20H26N2O5 — CID 123885715
5-[[4-ethoxy-3-(1H-indol-3-ylmethyl)-4-oxobutyl]amino]-5-oxopentanoic acid (PubChem CID 123885715) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-[[4-ethoxy-3-(1H-indol-3-ylmethyl)-4-oxobutyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-ethoxy-3-(1H-indol-3-ylmethyl)-4-oxobutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123885715 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 5-[[4-ethoxy-3-(1H-indol-3-ylmethyl)-4-oxobutyl]amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)C(CCNC(=O)CCCC(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H26N2O5/c1-2-27-20(26)14(10-11-21-18(23)8-5-9-19(24)25)12-15-13-22-17-7-4-3-6-16(15)17/h3-4,6-7,13-14,22H,2,5,8-12H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | AGZLJTJKNCBLCZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |