C27H32N6O2Si — CID 123885797
1-methyl-4-[2-[[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenoxy]methyl]-3-(2-trimethylsilylethynyl)phenyl]tetrazol-5-one (PubChem CID 123885797) has the molecular formula C27H32N6O2Si and a molecular weight of 500.68 g/mol. Its IUPAC name is 1-methyl-4-[2-[[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenoxy]methyl]-3-(2-trimethylsilylethynyl)phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[2-[[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenoxy]methyl]-3-(2-trimethylsilylethynyl)phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 123885797 |
| Molecular Formula | C27H32N6O2Si |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-methyl-4-[2-[[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenoxy]methyl]-3-(2-trimethylsilylethynyl)phenyl]tetrazol-5-one |
| SMILES | Cc1cc(-n2nc(C)c(C)c2C)ccc1OCc1c(C#C[Si](C)(C)C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C27H32N6O2Si/c1-18-16-23(32-21(4)19(2)20(3)28-32)12-13-26(18)35-17-24-22(14-15-36(6,7)8)10-9-11-25(24)33-27(34)31(5)29-30-33/h9-13,16H,17H2,1-8H3 |
| InChIKey | WRGJVXMAWCXYIC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|