C25H30ClFN4O — CID 123886418
6-[5-chloro-2-(cyclohexylamino)-4-pyridinyl]-3-fluoro-N-[(4-prop-1-ynyloxan-4-yl)methyl]pyridin-2-amine (PubChem CID 123886418) has the molecular formula C25H30ClFN4O and a molecular weight of 456.99 g/mol. Its IUPAC name is 6-[5-chloro-2-(cyclohexylamino)-4-pyridinyl]-3-fluoro-N-[(4-prop-1-ynyloxan-4-yl)methyl]pyridin-2-amine.
| Compound Name | 6-[5-chloro-2-(cyclohexylamino)-4-pyridinyl]-3-fluoro-N-[(4-prop-1-ynyloxan-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 123886418 |
| Molecular Formula | C25H30ClFN4O |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 6-[5-chloro-2-(cyclohexylamino)-4-pyridinyl]-3-fluoro-N-[(4-prop-1-ynyloxan-4-yl)methyl]pyridin-2-amine |
| SMILES | CC#CC1(CNc2nc(-c3cc(NC4CCCCC4)ncc3Cl)ccc2F)CCOCC1 |
| InChI | InChI=1S/C25H30ClFN4O/c1-2-10-25(11-13-32-14-12-25)17-29-24-21(27)8-9-22(31-24)19-15-23(28-16-20(19)26)30-18-6-4-3-5-7-18/h8-9,15-16,18H,3-7,11-14,17H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | JSHTYIKFPUOQOL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|