C22H22ClFN4O — CID 70794022
5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-N-(oxan-4-yl)pyridin-2-amine (PubChem CID 70794022) has the molecular formula C22H22ClFN4O and a molecular weight of 412.90 g/mol. Its IUPAC name is 5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-N-(oxan-4-yl)pyridin-2-amine.
| Compound Name | 5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-N-(oxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 70794022 |
| Molecular Formula | C22H22ClFN4O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-N-(oxan-4-yl)pyridin-2-amine |
| SMILES | Fc1cccc(CNc2cccc(-c3cc(NC4CCOCC4)ncc3Cl)n2)c1 |
| InChI | InChI=1S/C22H22ClFN4O/c23-19-14-26-22(27-17-7-9-29-10-8-17)12-18(19)20-5-2-6-21(28-20)25-13-15-3-1-4-16(24)11-15/h1-6,11-12,14,17H,7-10,13H2,(H,25,28)(H,26,27) |
| InChIKey | JCOMZLXSXWGRNX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |