C20H18ClFN4 — CID 67641420
5-chloro-N-cyclopropyl-4-[5-[(3-fluorophenyl)methylamino]-3-pyridinyl]pyridin-2-amine (PubChem CID 67641420) has the molecular formula C20H18ClFN4 and a molecular weight of 368.84 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-4-[5-[(3-fluorophenyl)methylamino]-3-pyridinyl]pyridin-2-amine.
| Compound Name | 5-chloro-N-cyclopropyl-4-[5-[(3-fluorophenyl)methylamino]-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 67641420 |
| Molecular Formula | C20H18ClFN4 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-chloro-N-cyclopropyl-4-[5-[(3-fluorophenyl)methylamino]-3-pyridinyl]pyridin-2-amine |
| SMILES | Fc1cccc(CNc2cncc(-c3cc(NC4CC4)ncc3Cl)c2)c1 |
| InChI | InChI=1S/C20H18ClFN4/c21-19-12-25-20(26-16-4-5-16)8-18(19)14-7-17(11-23-10-14)24-9-13-2-1-3-15(22)6-13/h1-3,6-8,10-12,16,24H,4-5,9H2,(H,25,26) |
| InChIKey | UJQNAUNIAJXYMV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |