C23H23ClFN3O — CID 70795337
5-chloro-N-cyclohexyl-4-[6-[(3-fluorophenyl)methoxy]-2-pyridinyl]pyridin-2-amine (PubChem CID 70795337) has the molecular formula C23H23ClFN3O and a molecular weight of 411.91 g/mol. Its IUPAC name is 5-chloro-N-cyclohexyl-4-[6-[(3-fluorophenyl)methoxy]-2-pyridinyl]pyridin-2-amine.
| Compound Name | 5-chloro-N-cyclohexyl-4-[6-[(3-fluorophenyl)methoxy]-2-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 70795337 |
| Molecular Formula | C23H23ClFN3O |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 5-chloro-N-cyclohexyl-4-[6-[(3-fluorophenyl)methoxy]-2-pyridinyl]pyridin-2-amine |
| SMILES | Fc1cccc(COc2cccc(-c3cc(NC4CCCCC4)ncc3Cl)n2)c1 |
| InChI | InChI=1S/C23H23ClFN3O/c24-20-14-26-22(27-18-8-2-1-3-9-18)13-19(20)21-10-5-11-23(28-21)29-15-16-6-4-7-17(25)12-16/h4-7,10-14,18H,1-3,8-9,15H2,(H,26,27) |
| InChIKey | YLWBMGIFHLJDLT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |