C24H27ClFN5 — CID 67691819
4-[2-[(4-aminocyclohexyl)amino]-5-chloro-4-pyridinyl]-2-N-[(3-fluorophenyl)methyl]benzene-1,2-diamine (PubChem CID 67691819) has the molecular formula C24H27ClFN5 and a molecular weight of 439.97 g/mol. Its IUPAC name is 4-[2-[(4-aminocyclohexyl)amino]-5-chloro-4-pyridinyl]-2-N-[(3-fluorophenyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-[2-[(4-aminocyclohexyl)amino]-5-chloro-4-pyridinyl]-2-N-[(3-fluorophenyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 67691819 |
| Molecular Formula | C24H27ClFN5 |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[2-[(4-aminocyclohexyl)amino]-5-chloro-4-pyridinyl]-2-N-[(3-fluorophenyl)methyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(-c2cc(NC3CCC(N)CC3)ncc2Cl)cc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C24H27ClFN5/c25-21-14-30-24(31-19-7-5-18(27)6-8-19)12-20(21)16-4-9-22(28)23(11-16)29-13-15-2-1-3-17(26)10-15/h1-4,9-12,14,18-19,29H,5-8,13,27-28H2,(H,30,31) |
| InChIKey | CLAXJTHYPZAFQR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|