C57H46O — CID 123886969
3-ethenyl-2-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4-[3-[3-(3-phenoxyphenyl)-4,5-diphenylphenyl]phenyl]naphthalene (PubChem CID 123886969) has the molecular formula C57H46O and a molecular weight of 746.99 g/mol. Its IUPAC name is 3-ethenyl-2-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4-[3-[3-(3-phenoxyphenyl)-4,5-diphenylphenyl]phenyl]naphthalene.
| Compound Name | 3-ethenyl-2-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4-[3-[3-(3-phenoxyphenyl)-4,5-diphenylphenyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 123886969 |
| Molecular Formula | C57H46O |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | 3-ethenyl-2-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4-[3-[3-(3-phenoxyphenyl)-4,5-diphenylphenyl]phenyl]naphthalene |
| SMILES | C=Cc1c(C)c(C(=C)C=C(C)C=CC)c2ccccc2c1-c1cccc(-c2cc(-c3ccccc3)c(-c3ccccc3)c(-c3cccc(Oc4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C57H46O/c1-6-21-39(3)34-40(4)55-41(5)50(7-2)57(52-33-18-17-32-51(52)55)46-28-19-26-44(35-46)47-37-53(42-22-11-8-12-23-42)56(43-24-13-9-14-25-43)54(38-47)45-27-20-31-49(36-45)58-48-29-15-10-16-30-48/h6-38H,2,4H2,1,3,5H3 |
| InChIKey | ZFORKNMYEUOZDV-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|