C38H36O — CID 145303198
1-[2,3-bis(ethenyl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-2,3-bis(ethenyl)-4-(4-methoxyphenyl)naphthalene (PubChem CID 145303198) has the molecular formula C38H36O and a molecular weight of 508.71 g/mol. Its IUPAC name is 1-[2,3-bis(ethenyl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-2,3-bis(ethenyl)-4-(4-methoxyphenyl)naphthalene.
| Compound Name | 1-[2,3-bis(ethenyl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-2,3-bis(ethenyl)-4-(4-methoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 145303198 |
| Molecular Formula | C38H36O |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 1-[2,3-bis(ethenyl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-2,3-bis(ethenyl)-4-(4-methoxyphenyl)naphthalene |
| SMILES | C=Cc1c(C(/C=C\C)=C/CC)ccc(-c2c(C=C)c(C=C)c(-c3ccc(OC)cc3)c3ccccc23)c1C=C |
| InChI | InChI=1S/C38H36O/c1-8-16-26(17-9-2)33-24-25-36(30(11-4)29(33)10-3)38-32(13-6)31(12-5)37(34-18-14-15-19-35(34)38)27-20-22-28(39-7)23-21-27/h8,10-25H,3-6,9H2,1-2,7H3/b16-8-,26-17+ |
| InChIKey | RADTUHOOKKTSFK-VRKKBYPOSA-N |
| XLogP | 11.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|