C49H38 — CID 143743108
8-[(2Z,4E)-hepta-2,4-dien-4-yl]-9-[(3E)-hexa-1,3,5-trien-3-yl]-7-naphthalen-1-yl-10-naphthalen-2-ylfluoranthene (PubChem CID 143743108) has the molecular formula C49H38 and a molecular weight of 626.84 g/mol. Its IUPAC name is 8-[(2Z,4E)-hepta-2,4-dien-4-yl]-9-[(3E)-hexa-1,3,5-trien-3-yl]-7-naphthalen-1-yl-10-naphthalen-2-ylfluoranthene.
| Compound Name | 8-[(2Z,4E)-hepta-2,4-dien-4-yl]-9-[(3E)-hexa-1,3,5-trien-3-yl]-7-naphthalen-1-yl-10-naphthalen-2-ylfluoranthene |
|---|---|
| PubChem CID | 143743108 |
| Molecular Formula | C49H38 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 8-[(2Z,4E)-hepta-2,4-dien-4-yl]-9-[(3E)-hexa-1,3,5-trien-3-yl]-7-naphthalen-1-yl-10-naphthalen-2-ylfluoranthene |
| SMILES | C=C/C=C(\C=C)c1c(C(/C=C\C)=C/CC)c(-c2cccc3ccccc23)c2c(c1-c1ccc3ccccc3c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C49H38/c1-5-16-32(8-4)44-45(35(17-6-2)18-7-3)47(40-26-13-22-34-20-11-12-25-39(34)40)49-42-28-15-24-36-23-14-27-41(43(36)42)48(49)46(44)38-30-29-33-19-9-10-21-37(33)31-38/h5-6,8-31H,1,4,7H2,2-3H3/b17-6-,32-16+,35-18+ |
| InChIKey | GGGJCFZYKVLLNT-BYNGSLPZSA-N |
| XLogP | 14.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|