C21H29ClN2O2 — CID 123887193
6-(4-chlorohexa-2,4-dien-3-yloxymethyl)-N-(1-cyclohexylethyl)pyridine-3-carboxamide (PubChem CID 123887193) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 6-(4-chlorohexa-2,4-dien-3-yloxymethyl)-N-(1-cyclohexylethyl)pyridine-3-carboxamide.
| Compound Name | 6-(4-chlorohexa-2,4-dien-3-yloxymethyl)-N-(1-cyclohexylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123887193 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 6-(4-chlorohexa-2,4-dien-3-yloxymethyl)-N-(1-cyclohexylethyl)pyridine-3-carboxamide |
| SMILES | CC=C(Cl)C(=CC)OCc1ccc(C(=O)NC(C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C21H29ClN2O2/c1-4-19(22)20(5-2)26-14-18-12-11-17(13-23-18)21(25)24-15(3)16-9-7-6-8-10-16/h4-5,11-13,15-16H,6-10,14H2,1-3H3,(H,24,25) |
| InChIKey | NAJBLLWGBSXYSX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|