C25H29F3N6O2 — CID 123887438
N-butyl-N-(2-methoxyethyl)-13-[3-(trifluoromethyl)anilino]-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide (PubChem CID 123887438) has the molecular formula C25H29F3N6O2 and a molecular weight of 502.54 g/mol. Its IUPAC name is N-butyl-N-(2-methoxyethyl)-13-[3-(trifluoromethyl)anilino]-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide.
| Compound Name | N-butyl-N-(2-methoxyethyl)-13-[3-(trifluoromethyl)anilino]-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 123887438 |
| Molecular Formula | C25H29F3N6O2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-butyl-N-(2-methoxyethyl)-13-[3-(trifluoromethyl)anilino]-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide |
| SMILES | CCCCN(CCOC)C(=O)c1[nH]nc2c1CCCc1cnc(Nc3cccc(C(F)(F)F)c3)nc1-2 |
| InChI | InChI=1S/C25H29F3N6O2/c1-3-4-11-34(12-13-36-2)23(35)22-19-10-5-7-16-15-29-24(31-20(16)21(19)32-33-22)30-18-9-6-8-17(14-18)25(26,27)28/h6,8-9,14-15H,3-5,7,10-13H2,1-2H3,(H,32,33)(H,29,30,31) |
| InChIKey | HACJMTLSNOSAMB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |