C19H15F3N4O2S — CID 123888113
5-[3-(4-methoxyphenyl)-7-oxo-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 123888113) has the molecular formula C19H15F3N4O2S and a molecular weight of 420.42 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)-7-oxo-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[3-(4-methoxyphenyl)-7-oxo-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 123888113 |
| Molecular Formula | C19H15F3N4O2S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)-7-oxo-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | COc1ccc(N2CCCC(=O)N(c3cnc(C#N)c(C(F)(F)F)c3)C2=S)cc1 |
| InChI | InChI=1S/C19H15F3N4O2S/c1-28-14-6-4-12(5-7-14)25-8-2-3-17(27)26(18(25)29)13-9-15(19(20,21)22)16(10-23)24-11-13/h4-7,9,11H,2-3,8H2,1H3 |
| InChIKey | HVPIGANTWPGLOH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|