C24H17F3N4OS — CID 123971856
5-[7-oxo-3-(4-phenylphenyl)-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 123971856) has the molecular formula C24H17F3N4OS and a molecular weight of 466.49 g/mol. Its IUPAC name is 5-[7-oxo-3-(4-phenylphenyl)-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[7-oxo-3-(4-phenylphenyl)-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 123971856 |
| Molecular Formula | C24H17F3N4OS |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 5-[7-oxo-3-(4-phenylphenyl)-2-sulfanylidene-1,3-diazepan-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(N2C(=O)CCCN(c3ccc(-c4ccccc4)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17F3N4OS/c25-24(26,27)20-13-19(15-29-21(20)14-28)31-22(32)7-4-12-30(23(31)33)18-10-8-17(9-11-18)16-5-2-1-3-6-16/h1-3,5-6,8-11,13,15H,4,7,12H2 |
| InChIKey | MKHFRUUPEVSCEK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|