C34H41N7O2 — CID 123888359
[4-[3-tert-butyl-5-[[[4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methylamino]pyrazol-1-yl]phenyl]methanol (PubChem CID 123888359) has the molecular formula C34H41N7O2 and a molecular weight of 579.75 g/mol. Its IUPAC name is [4-[3-tert-butyl-5-[[[4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methylamino]pyrazol-1-yl]phenyl]methanol.
| Compound Name | [4-[3-tert-butyl-5-[[[4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methylamino]pyrazol-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 123888359 |
| Molecular Formula | C34H41N7O2 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | [4-[3-tert-butyl-5-[[[4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methylamino]pyrazol-1-yl]phenyl]methanol |
| SMILES | CC(C)c1nnc2ccc(OC3CCC(NCNc4cc(C(C)(C)C)nn4-c4ccc(CO)cc4)c4ccccc43)cn12 |
| InChI | InChI=1S/C34H41N7O2/c1-22(2)33-38-37-31-17-14-25(19-40(31)33)43-29-16-15-28(26-8-6-7-9-27(26)29)35-21-36-32-18-30(34(3,4)5)39-41(32)24-12-10-23(20-42)11-13-24/h6-14,17-19,22,28-29,35-36,42H,15-16,20-21H2,1-5H3 |
| InChIKey | PVINTHPCUMTWCY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|