C22H27N5O2 — CID 137354725
[(1S,4R)-4-[(3-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 137354725) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is [(1S,4R)-4-[(3-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | [(1S,4R)-4-[(3-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 137354725 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [(1S,4R)-4-[(3-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | CCC(CC)c1nnc2ccc(O[C@@H]3CC[C@H](NC(N)=O)c4ccccc43)cn12 |
| InChI | InChI=1S/C22H27N5O2/c1-3-14(4-2)21-26-25-20-12-9-15(13-27(20)21)29-19-11-10-18(24-22(23)28)16-7-5-6-8-17(16)19/h5-9,12-14,18-19H,3-4,10-11H2,1-2H3,(H3,23,24,28)/t18-,19+/m0/s1 |
| InChIKey | RJGITARGOZYURI-RBUKOAKNSA-N |
| XLogP | 4.26 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |