C17H29NO3 — CID 123889214
methyl 1-(3,5-dimethylnon-8-enoyl)pyrrolidine-2-carboxylate (PubChem CID 123889214) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is methyl 1-(3,5-dimethylnon-8-enoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3,5-dimethylnon-8-enoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123889214 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | methyl 1-(3,5-dimethylnon-8-enoyl)pyrrolidine-2-carboxylate |
| SMILES | C=CCCC(C)CC(C)CC(=O)N1CCCC1C(=O)OC |
| InChI | InChI=1S/C17H29NO3/c1-5-6-8-13(2)11-14(3)12-16(19)18-10-7-9-15(18)17(20)21-4/h5,13-15H,1,6-12H2,2-4H3 |
| InChIKey | WXRVYOADCLYBLZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|